Difference between revisions of "CPD-14282"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-OXOPIMELOYL-COA == * common-name: ** 3-oxopimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(o...") |
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** sxljfgxgvbw...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPDQT-40 == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** 3-[(7'-methylthio)heptyl]malate |
* smiles: | * smiles: | ||
− | ** | + | ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sxljfgxgvbwoob-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 276.347 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-18200]] |
+ | * [[RXNQT-4178]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-18200]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=3-[(7'-methylthio)heptyl]malate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=276.347}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPDQT-40
- common-name:
- 3-[(7'-methylthio)heptyl]malate
- smiles:
- cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- sxljfgxgvbwoob-uhfffaoysa-l
- molecular-weight:
- 276.347
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(7'-methylthio)heptyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.