Difference between revisions of "CPD-14282"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-OXOPIMELOYL-COA == * common-name: ** 3-oxopimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-14282 == * common-name: ** trans-lignocer-2-enoyl-coa * smiles: ** cccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-OXOPIMELOYL-COA ==
+
== Metabolite CPD-14282 ==
 
* common-name:
 
* common-name:
** 3-oxopimeloyl-coa
+
** trans-lignocer-2-enoyl-coa
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** kjxfofktzdjlmq-uyrkptjqsa-i
+
** uvjkzcsqlmwpmv-lqjawxtisa-j
 
* molecular-weight:
 
* molecular-weight:
** 918.632
+
** 1112.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8032]]
+
* [[RXN-13308]]
 +
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10280/NAD//CPD-14282/NADH/PROTON.37.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8032]]
+
* [[RXN-13304]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxopimeloyl-coa}}
+
{{#set: common-name=trans-lignocer-2-enoyl-coa}}
{{#set: inchi-key=inchikey=kjxfofktzdjlmq-uyrkptjqsa-i}}
+
{{#set: inchi-key=inchikey=uvjkzcsqlmwpmv-lqjawxtisa-j}}
{{#set: molecular-weight=918.632}}
+
{{#set: molecular-weight=1112.113}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14282

  • common-name:
    • trans-lignocer-2-enoyl-coa
  • smiles:
    • cccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • uvjkzcsqlmwpmv-lqjawxtisa-j
  • molecular-weight:
    • 1112.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality