Difference between revisions of "CPD-14282"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** sxljfgxgvbw...")
(Created page with "Category:metabolite == Metabolite CPD-17332 == * common-name: ** 3-oxo-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPDQT-40 ==
+
== Metabolite CPD-17332 ==
 
* common-name:
 
* common-name:
** 3-[(7'-methylthio)heptyl]malate
+
** 3-oxo-tetracosapentaenoyl-coa
 
* smiles:
 
* smiles:
** cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
+
** ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** sxljfgxgvbwoob-uhfffaoysa-l
+
** uqpanogfyczrav-afqbpcmksa-j
 
* molecular-weight:
 
* molecular-weight:
** 276.347
+
** 1118.034
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18200]]
+
* [[RXN-16129]]
* [[RXNQT-4178]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18200]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(7'-methylthio)heptyl]malate}}
+
{{#set: common-name=3-oxo-tetracosapentaenoyl-coa}}
{{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=uqpanogfyczrav-afqbpcmksa-j}}
{{#set: molecular-weight=276.347}}
+
{{#set: molecular-weight=1118.034}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-17332

  • common-name:
    • 3-oxo-tetracosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • uqpanogfyczrav-afqbpcmksa-j
  • molecular-weight:
    • 1118.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality