Difference between revisions of "CPD-14300"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14705 == * common-name: ** 4-hydroxy-2-nonenal-[cys-gly] conjugate * smiles: ** cccccc(o)c(c[ch]=o)scc([n+])c(=o)ncc([o-])=o * inchi-...")
(Created page with "Category:metabolite == Metabolite CPD-14300 == * common-name: ** 3-oxo-(11z)-eicos-11-enoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14705 ==
+
== Metabolite CPD-14300 ==
 
* common-name:
 
* common-name:
** 4-hydroxy-2-nonenal-[cys-gly] conjugate
+
** 3-oxo-(11z)-eicos-11-enoyl-coa
 
* smiles:
 
* smiles:
** cccccc(o)c(c[ch]=o)scc([n+])c(=o)ncc([o-])=o
+
** ccccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** lqtwzqsulmrbee-uhfffaoysa-n
+
** askkpqkscfyppp-fvldfciysa-j
 
* molecular-weight:
 
* molecular-weight:
** 334.43
+
** 1069.99
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13677]]
+
* [[RXN-14484]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13675]]
+
* [[RXN-13322]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxy-2-nonenal-[cys-gly] conjugate}}
+
{{#set: common-name=3-oxo-(11z)-eicos-11-enoyl-coa}}
{{#set: inchi-key=inchikey=lqtwzqsulmrbee-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=askkpqkscfyppp-fvldfciysa-j}}
{{#set: molecular-weight=334.43}}
+
{{#set: molecular-weight=1069.99}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14300

  • common-name:
    • 3-oxo-(11z)-eicos-11-enoyl-coa
  • smiles:
    • ccccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • askkpqkscfyppp-fvldfciysa-j
  • molecular-weight:
    • 1069.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality