Difference between revisions of "CPD-14300"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-3-beta-D-Glucans == * common-name: ** a 1,3-β-d-glucan == Reaction(s) known to consume the compound == * 13-BETA-GLUCAN-SYNTHASE...")
(Created page with "Category:metabolite == Metabolite CPD-14300 == * common-name: ** 3-oxo-(11z)-eicos-11-enoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-3-beta-D-Glucans ==
+
== Metabolite CPD-14300 ==
 
* common-name:
 
* common-name:
** a 1,3-β-d-glucan
+
** 3-oxo-(11z)-eicos-11-enoyl-coa
 +
* smiles:
 +
** ccccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** askkpqkscfyppp-fvldfciysa-j
 +
* molecular-weight:
 +
** 1069.99
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
* [[RXN-14484]]
* [[3.2.1.39-RXN]]
 
* [[3.2.1.58-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
* [[RXN-13322]]
* [[3.2.1.39-RXN]]
 
* [[3.2.1.58-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1,3-β-d-glucan}}
+
{{#set: common-name=3-oxo-(11z)-eicos-11-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=askkpqkscfyppp-fvldfciysa-j}}
 +
{{#set: molecular-weight=1069.99}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14300

  • common-name:
    • 3-oxo-(11z)-eicos-11-enoyl-coa
  • smiles:
    • ccccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • askkpqkscfyppp-fvldfciysa-j
  • molecular-weight:
    • 1069.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality