Difference between revisions of "CPD-14375"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18447 == * common-name: ** actinocin * smiles: ** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3))) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-14375 == * common-name: ** a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine == Reaction(s) known to consume the compound == == Rea...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-14375 == |
* common-name: | * common-name: | ||
− | ** | + | ** a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[3.2.1.96-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-14375
- common-name:
- a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine