Difference between revisions of "CPD-14375"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19144 == * common-name: ** (7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite CPD-14375 == * common-name: ** a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine == Reaction(s) known to consume the compound == == Rea...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19144 ==
+
== Metabolite CPD-14375 ==
 
* common-name:
 
* common-name:
** (7z)-hexadecenoyl-coa
+
** a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine
* smiles:
 
** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** mjwmoldkmbisob-ydggzukgsa-j
 
* molecular-weight:
 
** 999.899
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17779]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17778]]
+
* [[3.2.1.96-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(7z)-hexadecenoyl-coa}}
+
{{#set: common-name=a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine}}
{{#set: inchi-key=inchikey=mjwmoldkmbisob-ydggzukgsa-j}}
 
{{#set: molecular-weight=999.899}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-14375

  • common-name:
    • a glycopeptide-d-mannosyl-n4-n-acetyl-d-glucosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality