Difference between revisions of "CPD-14378"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-D-GALACTURONATE == * common-name: ** udp-α-d-galacturonate * smiles: ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)...")
(Created page with "Category:metabolite == Metabolite CPD-14378 == * common-name: ** dehydrospermidine * smiles: ** c([n+])cc[n+]=cccc[n+] * inchi-key: ** yavlybvkpxlzeq-uxblzvdnsa-q * molecu...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-D-GALACTURONATE ==
+
== Metabolite CPD-14378 ==
 
* common-name:
 
* common-name:
** udp-α-d-galacturonate
+
** dehydrospermidine
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
+
** c([n+])cc[n+]=cccc[n+]
 
* inchi-key:
 
* inchi-key:
** hdyanyhvcapmjv-gxnrkqdosa-k
+
** yavlybvkpxlzeq-uxblzvdnsa-q
 
* molecular-weight:
 
* molecular-weight:
** 577.265
+
** 146.255
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
* [[RXN-13415]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
* [[RXN-13414]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-galacturonate}}
+
{{#set: common-name=dehydrospermidine}}
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-gxnrkqdosa-k}}
+
{{#set: inchi-key=inchikey=yavlybvkpxlzeq-uxblzvdnsa-q}}
{{#set: molecular-weight=577.265}}
+
{{#set: molecular-weight=146.255}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14378

  • common-name:
    • dehydrospermidine
  • smiles:
    • c([n+])cc[n+]=cccc[n+]
  • inchi-key:
    • yavlybvkpxlzeq-uxblzvdnsa-q
  • molecular-weight:
    • 146.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality