Difference between revisions of "CPD-14392"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-pseudouridine2457 == * common-name: ** a pseudouridine2457 in 23s rrna == Reaction(s) known to consume the compound == == Reacti...")
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23S-rRNA-pseudouridine2457 ==
+
== Metabolite CPD-14392 ==
 
* common-name:
 
* common-name:
** a pseudouridine2457 in 23s rrna
+
** stearidonoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** ddhcsalwdprvcn-uswkvxsksa-j
 +
* molecular-weight:
 +
** 1021.905
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11834]]
+
* [[RXN-13426]]
 +
* [[RXN-16041]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pseudouridine2457 in 23s rrna}}
+
{{#set: common-name=stearidonoyl-coa}}
 +
{{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}}
 +
{{#set: molecular-weight=1021.905}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-14392

  • common-name:
    • stearidonoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ddhcsalwdprvcn-uswkvxsksa-j
  • molecular-weight:
    • 1021.905

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality