Difference between revisions of "CPD-14404"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.128-RXN 2.1.1.128-RXN] == * direction: ** left-to-right * common-name: ** norcoclaurine 6-o-m...")
(Created page with "Category:metabolite == Metabolite CPD-14404 == * common-name: ** 3-oxo-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.128-RXN 2.1.1.128-RXN] ==
+
== Metabolite CPD-14404 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** norcoclaurine 6-o-methyltransferase
+
** 3-oxo-dihomo γ-linolenoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.128 ec-2.1.1.128]
+
** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[S-NORCOCLAURINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[S-COCLAURINE]][c]
+
** djfxnrbquufios-ddquopdjsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10724]]
+
** 1065.958
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12968]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-3581]], (S)-reticuline biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3581 PWY-3581]
+
* [[RXN-12777]]
−
** '''6''' reactions found over '''11''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=3-oxo-dihomo γ-linolenoyl-coa}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=djfxnrbquufios-ddquopdjsa-j}}
−
== External links  ==
+
{{#set: molecular-weight=1065.958}}
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19942 19942]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R05162 R05162]
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R05123 R05123]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=norcoclaurine 6-o-methyltransferase}}
 
−
{{#set: ec-number=ec-2.1.1.128}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-14404

  • common-name:
    • 3-oxo-dihomo γ-linolenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • djfxnrbquufios-ddquopdjsa-j
  • molecular-weight:
    • 1065.958

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14404&oldid=139749"