Difference between revisions of "CPD-14405"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OXYGEN-MOLECULE == * common-name: ** oxygen * smiles: ** o=o * inchi-key: ** mymofizgzyhomd-uhfffaoysa-n * molecular-weight: ** 31.999 ==...")
(Created page with "Category:metabolite == Metabolite CPD-15369 == * common-name: ** 3r-hydroxy-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OXYGEN-MOLECULE ==
+
== Metabolite CPD-15369 ==
 
* common-name:
 
* common-name:
** oxygen
+
** 3r-hydroxy-lesqueroloyl-coa
 
* smiles:
 
* smiles:
** o=o
+
** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** mymofizgzyhomd-uhfffaoysa-n
+
** chmqnmkvoyfhhx-sgpqcwjrsa-j
 
* molecular-weight:
 
* molecular-weight:
** 31.999
+
** 1088.005
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-14494]]
* [[1.1.3.37-RXN]]
 
* [[1.1.3.41-RXN]]
 
* [[1.14.11.1-RXN]]
 
* [[1.14.11.18-RXN]]
 
* [[1.14.11.2-RXN]]
 
* [[1.14.13.70-RXN]]
 
* [[1.14.13.78-RXN]]
 
* [[1.14.13.79-RXN]]
 
* [[1.14.13.8-RXN]]
 
* [[1.14.19.1-RXN]]
 
* [[1.14.19.3-RXN]]
 
* [[1.14.21.6-RXN]]
 
* [[1.14.99.33-RXN]]
 
* [[1.14.99.38-RXN]]
 
* [[1.2.3.14-RXN]]
 
* [[1.21.3.1-RXN]]
 
* [[1.3.3.12-RXN]]
 
* [[1.4.3.19-RXN]]
 
* [[1.8.3.5-RXN]]
 
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
 
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
 
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
 
* [[ACYL-COA-OXIDASE-RXN]]
 
* [[ALKANE-1-MONOOXYGENASE-RXN]]
 
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
 
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
 
* [[ARG-OXIDATION-RXN]]
 
* [[CYSTEAMINE-DIOXYGENASE-RXN]]
 
* [[CYSTEINE-DIOXYGENASE-RXN]]
 
* [[CYTOCHROME-C-OXIDASE-RXN]]
 
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
 
* [[ETHYL-RXN]]
 
* [[ExchangeSeed-OXYGEN-MOLECULE]]
 
* [[FESGSHTHIO-RXN]]
 
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
 
* [[GLYOXYLATE-OXIDASE-RXN]]
 
* [[HDAO10x]]
 
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 
* [[HPPD]]
 
* [[INDOLE-23-DIOXYGENASE-RXN]]
 
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
 
* [[L-AMINO-ACID-OXIDASE-RXN]]
 
* [[L-ASPARTATE-OXID-RXN]]
 
* [[L-GULONOLACTONE-OXIDASE-RXN]]
 
* [[LACCASE-RXN]]
 
* [[LIPOXYGENASE-RXN]]
 
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
 
* [[MYO-INOSITOL-OXYGENASE-RXN]]
 
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
* [[NODOx]]
 
* [[NODOy]]
 
* [[O-AMINOPHENOL-OXIDASE-RXN]]
 
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 
* [[PHOSPHATIDYLCHOLINE-DESATURASE-RXN]]
 
* [[PMPOXI-RXN]]
 
* [[PNPOXI-RXN]]
 
* [[PPPGO]]
 
* [[PROTOPORGENOXI-RXN]]
 
* [[PYRIDOXINE-4-OXIDASE-RXN]]
 
* [[QUERCETIN-23-DIOXYGENASE-RXN]]
 
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 
* [[R147-RXN]]
 
* [[R621-RXN]]
 
* [[RXN-1]]
 
* [[RXN-10078]]
 
* [[RXN-10079]]
 
* [[RXN-10664]]
 
* [[RXN-10696]]
 
* [[RXN-10706]]
 
* [[RXN-10707]]
 
* [[RXN-10745]]
 
* [[RXN-10778]]
 
* [[RXN-10815]]
 
* [[RXN-10817]]
 
* [[RXN-10907]]
 
* [[RXN-10908]]
 
* [[RXN-10910]]
 
* [[RXN-10913]]
 
* [[RXN-11026]]
 
* [[RXN-11026-PALMITYL-COA/OXYGEN-MOLECULE//CPD0-2117/HYDROGEN-PEROXIDE.58.]]
 
* [[RXN-11056]]
 
* [[RXN-11057]]
 
* [[RXN-11067]]
 
* [[RXN-1121]]
 
* [[RXN-113]]
 
* [[RXN-11320]]
 
* [[RXN-11321]]
 
* [[RXN-115]]
 
* [[RXN-11519]]
 
* [[RXN-11520]]
 
* [[RXN-11521]]
 
* [[RXN-11623]]
 
* [[RXN-11680]]
 
* [[RXN-11681]]
 
* [[RXN-11682]]
 
* [[RXN-11783]]
 
* [[RXN-11881]]
 
* [[RXN-11887]]
 
* [[RXN-11989]]
 
* [[RXN-12353]]
 
* [[RXN-12510]]
 
* [[RXN-12518]]
 
* [[RXN-12614]]
 
* [[RXN-12615]]
 
* [[RXN-12669]]
 
* [[RXN-12701]]
 
* [[RXN-12755]]
 
* [[RXN-12848]]
 
* [[RXN-12849]]
 
* [[RXN-12850]]
 
* [[RXN-13061]]
 
* [[RXN-13064]]
 
* [[RXN-13159]]
 
* [[RXN-13161]]
 
* [[RXN-13186]]
 
* [[RXN-1321]]
 
* [[RXN-13395]]
 
* [[RXN-13398]]
 
* [[RXN-13426]]
 
* [[RXN-13492]]
 
* [[RXN-13493]]
 
* [[RXN-13494]]
 
* [[RXN-13506]]
 
* [[RXN-13564]]
 
* [[RXN-13565]]
 
* [[RXN-13689]]
 
* [[RXN-13707]]
 
* [[RXN-13709]]
 
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4702/NAD/WATER.76.]]
 
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4702/NADP/WATER.78.]]
 
* [[RXN-13712]]
 
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4577/NAD/WATER.79.]]
 
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4577/NADP/WATER.81.]]
 
* [[RXN-13868]]
 
* [[RXN-13883]]
 
* [[RXN-13892]]
 
* [[RXN-13961]]
 
* [[RXN-1401]]
 
* [[RXN-14430]]
 
* [[RXN-14491]]
 
* [[RXN-14576]]
 
* [[RXN-14771]]
 
* [[RXN-14775]]
 
* [[RXN-14785]]
 
* [[RXN-14789]]
 
* [[RXN-14796]]
 
* [[RXN-15029]]
 
* [[RXN-15414]]
 
* [[RXN-15684]]
 
* [[RXN-15830]]
 
* [[RXN-16040]]
 
* [[RXN-16046]]
 
* [[RXN-16049]]
 
* [[RXN-16052]]
 
* [[RXN-16053]]
 
* [[RXN-16065]]
 
* [[RXN-16070]]
 
* [[RXN-16071]]
 
* [[RXN-16099]]
 
* [[RXN-16101]]
 
* [[RXN-16132]]
 
* [[RXN-16134]]
 
* [[RXN-16149]]
 
* [[RXN-16322]]
 
* [[RXN-16378]]
 
* [[RXN-16993]]
 
* [[RXN-16994]]
 
* [[RXN-17067]]
 
* [[RXN-17077]]
 
* [[RXN-171]]
 
* [[RXN-17105]]
 
* [[RXN-17112]]
 
* [[RXN-17113]]
 
* [[RXN-17130]]
 
* [[RXN-1725]]
 
* [[RXN-17252]]
 
* [[RXN-1727]]
 
* [[RXN-17335]]
 
* [[RXN-17351]]
 
* [[RXN-17517]]
 
* [[RXN-17523]]
 
* [[RXN-17625]]
 
* [[RXN-17627]]
 
* [[RXN-17644]]
 
* [[RXN-17653]]
 
* [[RXN-17654]]
 
* [[RXN-17655]]
 
* [[RXN-17811]]
 
* [[RXN-17951]]
 
* [[RXN-19202]]
 
* [[RXN-3661]]
 
* [[RXN-4209]]
 
* [[RXN-4225]]
 
* [[RXN-4231]]
 
* [[RXN-4444]]
 
* [[RXN-5242]]
 
* [[RXN-527]]
 
* [[RXN-5821]]
 
* [[RXN-5861]]
 
* [[RXN-602]]
 
* [[RXN-6550]]
 
* [[RXN-6883]]
 
* [[RXN-698]]
 
* [[RXN-715]]
 
* [[RXN-7580]]
 
* [[RXN-7648]]
 
* [[RXN-7651]]
 
* [[RXN-7676]]
 
* [[RXN-7677]]
 
* [[RXN-773]]
 
* [[RXN-7740]]
 
* [[RXN-7775]]
 
* [[RXN-7796]]
 
* [[RXN-7922]]
 
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
 
* [[RXN-7978]]
 
* [[RXN-7979]]
 
* [[RXN-8025]]
 
* [[RXN-8026]]
 
* [[RXN-8295]]
 
* [[RXN-8297]]
 
* [[RXN-8299]]
 
* [[RXN-8301]]
 
* [[RXN-8303]]
 
* [[RXN-8306]]
 
* [[RXN-8309]]
 
* [[RXN-8310]]
 
* [[RXN-8311]]
 
* [[RXN-8313]]
 
* [[RXN-8314]]
 
* [[RXN-8317]]
 
* [[RXN-8318]]
 
* [[RXN-8319]]
 
* [[RXN-8320]]
 
* [[RXN-8321]]
 
* [[RXN-8322]]
 
* [[RXN-8323]]
 
* [[RXN-8324]]
 
* [[RXN-8325]]
 
* [[RXN-8326]]
 
* [[RXN-8327]]
 
* [[RXN-8328]]
 
* [[RXN-8329]]
 
* [[RXN-8330]]
 
* [[RXN-8331]]
 
* [[RXN-8347]]
 
* [[RXN-8360]]
 
* [[RXN-8361]]
 
* [[RXN-8364]]
 
* [[RXN-8365]]
 
* [[RXN-8366]]
 
* [[RXN-8367]]
 
* [[RXN-8368]]
 
* [[RXN-8450]]
 
* [[RXN-8460]]
 
* [[RXN-8497]]
 
* [[RXN-8630]]
 
* [[RXN-8660]]
 
* [[RXN-8661]]
 
* [[RXN-8664]]
 
* [[RXN-8665]]
 
* [[RXN-8672]]
 
* [[RXN-8673]]
 
* [[RXN-8674]]
 
* [[RXN-8872]]
 
* [[RXN-9598]]
 
* [[RXN-9601]]
 
* [[RXN-9616]]
 
* [[RXN-9667]]
 
* [[RXN-9669]]
 
* [[RXN-969]]
 
* [[RXN-9912]]
 
* [[RXN-9914]]
 
* [[RXN-9926]]
 
* [[RXN0-1461]]
 
* [[RXN0-1483]]
 
* [[RXN0-7090]]
 
* [[RXN0-984]]
 
* [[RXN0-985]]
 
* [[RXN0-986]]
 
* [[RXN1F-152]]
 
* [[RXN1F-160]]
 
* [[RXN1F-161]]
 
* [[RXN1F-162]]
 
* [[RXN1F-163]]
 
* [[RXN1F-165]]
 
* [[RXN1F-167]]
 
* [[RXN1F-168]]
 
* [[RXN1F-93]]
 
* [[RXN3O-130]]
 
* [[RXN3O-218]]
 
* [[RXN490-3641]]
 
* [[RXN66-11]]
 
* [[RXN66-12]]
 
* [[RXN66-13]]
 
* [[RXN66-146]]
 
* [[RXN66-161]]
 
* [[RXN66-163]]
 
* [[RXN66-169]]
 
* [[RXN66-181]]
 
* [[RXN66-303]]
 
* [[RXN66-304]]
 
* [[RXN66-305]]
 
* [[RXN66-470]]
 
* [[RXN66-81]]
 
* [[RXN6666-4]]
 
* [[RXNDQC-2]]
 
* [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
 
* [[SALICYLATE-1-MONOOXYGENASE-RXN]]
 
* [[SMO]]
 
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
* [[SULFITE-OXIDASE-RXN]]
 
* [[THIOL-OXIDASE-RXN]]
 
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
 
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 
* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
 
* [[TransportSeed-OXYGEN-MOLECULE]]
 
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
* [[URATE-OXIDASE-RXN]]
 
* [[XANTHINE-OXIDASE-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CATAL-RXN]]
+
* [[RXN-14493]]
* [[ExchangeSeed-OXYGEN-MOLECULE]]
 
* [[PSII-RXN]]
 
* [[RXN-16378]]
 
* [[RXN-16993]]
 
* [[RXN-16994]]
 
* [[RXN-17077]]
 
* [[RXN-17627]]
 
* [[RXN-17811]]
 
* [[SMO]]
 
* [[SUPEROX-DISMUT-RXN]]
 
* [[TransportSeed-OXYGEN-MOLECULE]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxygen}}
+
{{#set: common-name=3r-hydroxy-lesqueroloyl-coa}}
{{#set: inchi-key=inchikey=mymofizgzyhomd-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=chmqnmkvoyfhhx-sgpqcwjrsa-j}}
{{#set: molecular-weight=31.999}}
+
{{#set: molecular-weight=1088.005}}

Revision as of 11:16, 15 January 2021

Metabolite CPD-15369

  • common-name:
    • 3r-hydroxy-lesqueroloyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • chmqnmkvoyfhhx-sgpqcwjrsa-j
  • molecular-weight:
    • 1088.005

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality