Difference between revisions of "CPD-14405"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15369 == * common-name: ** 3r-hydroxy-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...") |
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CYS-GLY == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-cysteinyl-glycine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c([o-])=o)nc(c(cs)[n+])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zukpvrwzdmrieo-vkhmyheasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 178.206 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-6622]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12618]] |
| + | * [[RXN-18092]] | ||
| + | * [[RXN-6601]] | ||
| + | * [[RXN-9157]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-cysteinyl-glycine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=178.206}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite CYS-GLY
- common-name:
- l-cysteinyl-glycine
- smiles:
- c(c([o-])=o)nc(c(cs)[n+])=o
- inchi-key:
- zukpvrwzdmrieo-vkhmyheasa-n
- molecular-weight:
- 178.206
