Difference between revisions of "CPD-14405"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20499 == * transcription-direction: ** positive * right-end-position: ** 124407 * left-end-position: ** 118532 * centisome-position: ** 19.179222...") |
(Created page with "Category:metabolite == Metabolite CPD-14405 == * common-name: ** 3r-hydroxy-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14405 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3r-hydroxy-dihomo γ-linolenoyl-coa |
| − | + | * smiles: | |
| − | + | ** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
| − | + | * inchi-key: | |
| − | * | + | ** gfvfsxuaklzogc-nulwuihisa-j |
| − | + | * molecular-weight: | |
| − | ** | + | ** 1067.974 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-12969]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-12968]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | ** | + | {{#set: common-name=3r-hydroxy-dihomo γ-linolenoyl-coa}} |
| − | + | {{#set: inchi-key=inchikey=gfvfsxuaklzogc-nulwuihisa-j}} | |
| − | * | + | {{#set: molecular-weight=1067.974}} |
| − | ** | ||
| − | * | ||
| − | * | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-14405
- common-name:
- 3r-hydroxy-dihomo γ-linolenoyl-coa
- smiles:
- cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- gfvfsxuaklzogc-nulwuihisa-j
- molecular-weight:
- 1067.974
