Difference between revisions of "CPD-14405"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-O-Methylguanosine18 == * common-name: ** a 2'-o-methylguanosine18 in trna == Reaction(s) known to consume the compound == == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite CPD-19154 == * common-name: ** (s)-3-hydroxy-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19154 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-3-hydroxy-(7z)-tetradecenoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** wgcarzjtijiwsl-jcjyipitsa-j | ||
| + | * molecular-weight: | ||
| + | ** 987.845 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17794]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17793]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-3-hydroxy-(7z)-tetradecenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=wgcarzjtijiwsl-jcjyipitsa-j}} | ||
| + | {{#set: molecular-weight=987.845}} | ||
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-19154
- common-name:
- (s)-3-hydroxy-(7z)-tetradecenoyl-coa
- smiles:
- ccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- wgcarzjtijiwsl-jcjyipitsa-j
- molecular-weight:
- 987.845
