|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINE--TRNA-LIGASE-RXN HISTIDINE--TRNA-LIGASE-RXN] == | + | == Metabolite CPD-14406 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** histidine-trna ligase | + | ** (2e,8z,11z,14z)-icosatetraenoyl-coa |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.1.1.21 ec-6.1.1.21] | + | ** cccccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[HIS]][c] '''+''' 1 [[HIS-tRNAs]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Charged-HIS-tRNAs]][c] '''+''' 1 [[PPI]][c]
| + | ** wqdzfnibnfnrlf-xblgnfgosa-j |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ21166]]
| + | ** 1049.959 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-12971]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN-12969]] |
| − | * Gene: [[SJ07221]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=(2e,8z,11z,14z)-icosatetraenoyl-coa}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: inchi-key=inchikey=wqdzfnibnfnrlf-xblgnfgosa-j}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=1049.959}} |
| − | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | |
| − | ** '''21''' reactions found over '''21''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17314 17314]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03655 R03655]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9X0H5 Q9X0H5]
| |
| − | ** [http://www.uniprot.org/uniprot/O58028 O58028]
| |
| − | ** [http://www.uniprot.org/uniprot/O67223 O67223]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZK27 Q9ZK27]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PPF4 Q9PPF4]
| |
| − | ** [http://www.uniprot.org/uniprot/P56455 P56455]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58406 Q58406]
| |
| − | ** [http://www.uniprot.org/uniprot/O32039 O32039]
| |
| − | ** [http://www.uniprot.org/uniprot/O51160 O51160]
| |
| − | ** [http://www.uniprot.org/uniprot/O66522 O66522]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZDL9 Q9ZDL9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JUZ9 Q9JUZ9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CE78 Q9CE78]
| |
| − | ** [http://www.uniprot.org/uniprot/P47281 P47281]
| |
| − | ** [http://www.uniprot.org/uniprot/O34459 O34459]
| |
| − | ** [http://www.uniprot.org/uniprot/O83647 O83647]
| |
| − | ** [http://www.uniprot.org/uniprot/O84547 O84547]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z7P1 Q9Z7P1]
| |
| − | ** [http://www.uniprot.org/uniprot/P43823 P43823]
| |
| − | ** [http://www.uniprot.org/uniprot/Q61035 Q61035]
| |
| − | ** [http://www.uniprot.org/uniprot/P30053 P30053]
| |
| − | ** [http://www.uniprot.org/uniprot/P46696 P46696]
| |
| − | ** [http://www.uniprot.org/uniprot/P51348 P51348]
| |
| − | ** [http://www.uniprot.org/uniprot/P75069 P75069]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55653 Q55653]
| |
| − | ** [http://www.uniprot.org/uniprot/Q49027 Q49027]
| |
| − | ** [http://www.uniprot.org/uniprot/P07263 P07263]
| |
| − | ** [http://www.uniprot.org/uniprot/P60906 P60906]
| |
| − | ** [http://www.uniprot.org/uniprot/P12081 P12081]
| |
| − | ** [http://www.uniprot.org/uniprot/P93422 P93422]
| |
| − | ** [http://www.uniprot.org/uniprot/O82413 O82413]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=histidine-trna ligase}} | |
| − | {{#set: ec-number=ec-6.1.1.21}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
