Difference between revisions of "CPD-14407"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-Substituted-L-Cysteines == * common-name: ** an l-cysteine-s-conjugate == Reaction(s) known to consume the compound == * RXN-15582...") |
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14407 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihomo γ-linolenoyl-coa |
| + | * smiles: | ||
| + | ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** fjwjalrunnzibb-ddquopdjsa-j | ||
| + | * molecular-weight: | ||
| + | ** 1051.975 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13435]] |
| − | * [[RXN- | + | * [[RXN-16044]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12971]] |
| − | * [[RXN- | + | * [[RXN-17105]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihomo γ-linolenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}} | ||
| + | {{#set: molecular-weight=1051.975}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-14407
- common-name:
- dihomo γ-linolenoyl-coa
- smiles:
- cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- fjwjalrunnzibb-ddquopdjsa-j
- molecular-weight:
- 1051.975
