Difference between revisions of "CPD-14420"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17541 == * common-name: ** dapdiamide c * smiles: ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** mjpkmdapfrgjgv-f...")
(Created page with "Category:metabolite == Metabolite CPD-14420 == * common-name: ** icosatrienoyl-2-enoyl coa * smiles: ** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17541 ==
+
== Metabolite CPD-14420 ==
 
* common-name:
 
* common-name:
** dapdiamide c
+
** icosatrienoyl-2-enoyl coa
 
* smiles:
 
* smiles:
** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
+
** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** mjpkmdapfrgjgv-fbfnwgnusa-n
+
** yjkoikylhsmlhc-atrrwjjysa-j
 
* molecular-weight:
 
* molecular-weight:
** 314.341
+
** 1049.959
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16293]]
+
* [[RXN-13001]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dapdiamide c}}
+
{{#set: common-name=icosatrienoyl-2-enoyl coa}}
{{#set: inchi-key=inchikey=mjpkmdapfrgjgv-fbfnwgnusa-n}}
+
{{#set: inchi-key=inchikey=yjkoikylhsmlhc-atrrwjjysa-j}}
{{#set: molecular-weight=314.341}}
+
{{#set: molecular-weight=1049.959}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14420

  • common-name:
    • icosatrienoyl-2-enoyl coa
  • smiles:
    • ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • yjkoikylhsmlhc-atrrwjjysa-j
  • molecular-weight:
    • 1049.959

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality