Difference between revisions of "CPD-14420"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) * inc...") |
(Created page with "Category:metabolite == Metabolite CPD-14420 == * common-name: ** icosatrienoyl-2-enoyl coa * smiles: ** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14420 == |
* common-name: | * common-name: | ||
− | ** | + | ** icosatrienoyl-2-enoyl coa |
* smiles: | * smiles: | ||
− | ** c(op([o-])(=o)[o-]) | + | ** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yjkoikylhsmlhc-atrrwjjysa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1049.959 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13001]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=icosatrienoyl-2-enoyl coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yjkoikylhsmlhc-atrrwjjysa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1049.959}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14420
- common-name:
- icosatrienoyl-2-enoyl coa
- smiles:
- ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- yjkoikylhsmlhc-atrrwjjysa-j
- molecular-weight:
- 1049.959