Difference between revisions of "CPD-14420"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLHOMOSER-CYS-RXN ACETYLHOMOSER-CYS-RXN] == * direction: ** reversible * ec-number: ** [http://...")
 
(Created page with "Category:metabolite == Metabolite CPD-14420 == * common-name: ** icosatrienoyl-2-enoyl coa * smiles: ** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLHOMOSER-CYS-RXN ACETYLHOMOSER-CYS-RXN] ==
+
== Metabolite CPD-14420 ==
* direction:
+
* common-name:
** reversible
+
** icosatrienoyl-2-enoyl coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.5.1.49 ec-2.5.1.49]
+
** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-667]][c] '''+''' 1 [[HS]][c] '''<=>''' 1 [[ACET]][c] '''+''' 1 [[HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
+
** yjkoikylhsmlhc-atrrwjjysa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ20026]]
+
** 1049.959
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-13001]]
* [[PWY-5344]], L-homocysteine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5344 PWY-5344]
+
== Reaction(s) of unknown directionality ==
** '''2''' reactions found over '''2''' reactions in the full pathway
+
{{#set: common-name=icosatrienoyl-2-enoyl coa}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=yjkoikylhsmlhc-atrrwjjysa-j}}
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=1049.959}}
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27825 27825]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01287 R01287]
 
{{#set: direction=reversible}}
 
{{#set: ec-number=ec-2.5.1.49}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14420

  • common-name:
    • icosatrienoyl-2-enoyl coa
  • smiles:
    • ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • yjkoikylhsmlhc-atrrwjjysa-j
  • molecular-weight:
    • 1049.959

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality