Difference between revisions of "CPD-14420"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNDQC-2 RXNDQC-2] == * direction: ** left-to-right * common-name: ** indole-3-pyruvate monooxygena...") |
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) * inc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 5-phospho-β-d-ribosylamine |
− | * | + | * smiles: |
− | ** [ | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) |
− | = | + | * inchi-key: |
− | + | ** skcbpevygoqgjn-txicztdvsa-m | |
− | + | * molecular-weight: | |
− | * | + | ** 228.118 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[GLYRIBONUCSYN-RXN]] |
− | == | + | * [[PRPPAMIDOTRANS-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[PRPPAMIDOTRANS-RXN]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5-phospho-β-d-ribosylamine}} | |
− | == | + | {{#set: inchi-key=inchikey=skcbpevygoqgjn-txicztdvsa-m}} |
− | * | + | {{#set: molecular-weight=228.118}} |
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:35, 18 December 2020
Contents
Metabolite 5-P-BETA-D-RIBOSYL-AMINE
- common-name:
- 5-phospho-β-d-ribosylamine
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
- inchi-key:
- skcbpevygoqgjn-txicztdvsa-m
- molecular-weight:
- 228.118