|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-KINASE-RXN SHIKIMATE-KINASE-RXN] == | + | == Metabolite CPD-14422 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** shikimate kinase | + | ** 3-oxo-icosatrienoyl-coa |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.1.71 ec-2.7.1.71] | + | ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[SHIKIMATE]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SHIKIMATE-5P]][c]
| + | ** dfyfqqxxtclfng-ubqhhbpxsa-j |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ04949]]
| + | ** 1065.958 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-12994]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-13441]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=3-oxo-icosatrienoyl-coa}} |
| − | * Gene: [[SJ10493]]
| + | {{#set: inchi-key=inchikey=dfyfqqxxtclfng-ubqhhbpxsa-j}} |
| − | ** Category: [[annotation]] | + | {{#set: molecular-weight=1065.958}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ05909]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163] | |
| − | ** '''6''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13124 13124]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02412 R02412]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P0A6D7 P0A6D7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PIB5 Q9PIB5]
| |
| − | ** [http://www.uniprot.org/uniprot/P07547 P07547]
| |
| − | ** [http://www.uniprot.org/uniprot/P08566 P08566]
| |
| − | ** [http://www.uniprot.org/uniprot/P43880 P43880]
| |
| − | ** [http://www.uniprot.org/uniprot/P63600 P63600]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CEU1 Q9CEU1]
| |
| − | ** [http://www.uniprot.org/uniprot/P37944 P37944]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A6E1 P0A6E1]
| |
| − | ** [http://www.uniprot.org/uniprot/P10880 P10880]
| |
| − | ** [http://www.uniprot.org/uniprot/Q00497 Q00497]
| |
| − | ** [http://www.uniprot.org/uniprot/P34003 P34003]
| |
| − | ** [http://www.uniprot.org/uniprot/P43906 P43906]
| |
| − | ** [http://www.uniprot.org/uniprot/P72796 P72796]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=shikimate kinase}} | |
| − | {{#set: ec-number=ec-2.7.1.71}}
| |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
