Difference between revisions of "CPD-14425"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16129 RXN-16129] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:metabolite == Metabolite CPD-14425 == * common-name: ** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16129 RXN-16129] ==
+
== Metabolite CPD-14425 ==
* direction:
+
* common-name:
** left-to-right
+
** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.1.330 ec-1.1.1.330]
+
** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-17332]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-17382]][c] '''+''' 1 [[NADP]][c]
+
** hgvxutaezaltig-hkhrklhhsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ06969]]
+
** 1073.981
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-13444]]
* [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606]
+
== Reaction(s) of unknown directionality ==
** '''8''' reactions found over '''14''' reactions in the full pathway
+
{{#set: common-name=(2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=hgvxutaezaltig-hkhrklhhsa-j}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=1073.981}}
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-1.1.1.330}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14425

  • common-name:
    • (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hgvxutaezaltig-hkhrklhhsa-j
  • molecular-weight:
    • 1073.981

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality