Difference between revisions of "CPD-14443"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONOSYLTRANSFERASE-RXN UDP-GLUCURONOSYLTRANSFERASE-RXN] == * direction: ** left-to-right *...")
(Created page with "Category:metabolite == Metabolite CPD-14443 == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) * inchi-k...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONOSYLTRANSFERASE-RXN UDP-GLUCURONOSYLTRANSFERASE-RXN] ==
+
== Metabolite CPD-14443 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** glucuronosyltransferase
+
** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.4.1.17 ec-2.4.1.17]
+
** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o)
== Reaction formula ==
+
* inchi-key:
* 1 [[Non-Glucur-Glucuronoside-Acceptors]][c] '''+''' 1 [[UDP-GLUCURONATE]][c] '''=>''' 1 [[Glucuronosylated-Glucuronoside-Acceptors]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
+
** dvtpryhenfbcii-imjsidkusa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 185.136
* Gene: [[SJ22626]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-14014]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ01409]]
+
* [[DIHYDRODIPICSYN-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=(2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
* Gene: [[SJ07780]]
+
{{#set: inchi-key=inchikey=dvtpryhenfbcii-imjsidkusa-l}}
** Category: [[annotation]]
+
{{#set: molecular-weight=185.136}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ07900]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ07398]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ02722]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ01052]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ20720]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ08300]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ22623]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ08296]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ11522]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ08295]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ14184]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ22094]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ16943]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ14192]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ21933]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ07670]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ07898]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01383 R01383]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P08430 P08430]
 
** [http://www.uniprot.org/uniprot/P19224 P19224]
 
** [http://www.uniprot.org/uniprot/P20720 P20720]
 
** [http://www.uniprot.org/uniprot/P16662 P16662]
 
** [http://www.uniprot.org/uniprot/P19488 P19488]
 
** [http://www.uniprot.org/uniprot/P22309 P22309]
 
** [http://www.uniprot.org/uniprot/P08541 P08541]
 
** [http://www.uniprot.org/uniprot/P09875 P09875]
 
** [http://www.uniprot.org/uniprot/P54855 P54855]
 
** [http://www.uniprot.org/uniprot/Q64435 Q64435]
 
** [http://www.uniprot.org/uniprot/P36512 P36512]
 
** [http://www.uniprot.org/uniprot/Q28611 Q28611]
 
** [http://www.uniprot.org/uniprot/P36513 P36513]
 
** [http://www.uniprot.org/uniprot/Q64550 Q64550]
 
** [http://www.uniprot.org/uniprot/P06133 P06133]
 
** [http://www.uniprot.org/uniprot/P17717 P17717]
 
** [http://www.uniprot.org/uniprot/P36511 P36511]
 
** [http://www.uniprot.org/uniprot/Q9TR24 Q9TR24]
 
** [http://www.uniprot.org/uniprot/Q7BLV3 Q7BLV3]
 
</div>
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=glucuronosyltransferase}}
 
{{#set: ec-number=ec-2.4.1.17}}
 
{{#set: nb gene associated=20}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14443

  • common-name:
    • (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
  • smiles:
    • c1(c(o)cc(=nc1c([o-])=o)c([o-])=o)
  • inchi-key:
    • dvtpryhenfbcii-imjsidkusa-l
  • molecular-weight:
    • 185.136

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality