Difference between revisions of "CPD-14483"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-341 == * common-name: ** s-succinyl-dihydrolipoamide * smiles: ** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs * inchi-key: ** rjcjwoncskshes...")
(Created page with "Category:metabolite == Metabolite CPD-14483 == * common-name: ** glycyrrhetinate * smiles: ** cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc(c([o-])=o)(c)cc5...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-341 ==
+
== Metabolite CPD-14483 ==
 
* common-name:
 
* common-name:
** s-succinyl-dihydrolipoamide
+
** glycyrrhetinate
 
* smiles:
 
* smiles:
** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
+
** cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc(c([o-])=o)(c)cc5)c))))
 
* inchi-key:
 
* inchi-key:
** rjcjwoncskshes-vifpvbqesa-m
+
** mpdghejmbkotsu-vopryamfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 306.414
+
** 469.683
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKGDHe2r]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AKGDHe2r]]
+
* [[RXN-13494]]
* [[AKGDHmi]]
+
* [[RXN-13506]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-succinyl-dihydrolipoamide}}
+
{{#set: common-name=glycyrrhetinate}}
{{#set: inchi-key=inchikey=rjcjwoncskshes-vifpvbqesa-m}}
+
{{#set: inchi-key=inchikey=mpdghejmbkotsu-vopryamfsa-m}}
{{#set: molecular-weight=306.414}}
+
{{#set: molecular-weight=469.683}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-14483

  • common-name:
    • glycyrrhetinate
  • smiles:
    • cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc(c([o-])=o)(c)cc5)c))))
  • inchi-key:
    • mpdghejmbkotsu-vopryamfsa-m
  • molecular-weight:
    • 469.683

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality