Difference between revisions of "CPD-14594"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9205 RXN-9205] == * direction: ** left-to-right * common-name: ** s-adenosylmethionine:2-demeth...")
(Created page with "Category:metabolite == Metabolite CPD-14594 == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** fersmfqb...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9205 RXN-9205] ==
+
== Metabolite CPD-14594 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** s-adenosylmethionine:2-demethylmenaquinol-9 methyltransferase
+
** linustatin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.163 ec-2.1.1.163]
+
** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-12118]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-12126]][c] '''+''' 1 [[PROTON]][c]
+
** fersmfqbwvbkqk-cxttvelosa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ02842]]
+
** 409.389
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13602]]
−
* Gene: [[SJ20751]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=linustatin}}
−
* Gene: [[SJ11757]]
+
{{#set: inchi-key=inchikey=fersmfqbwvbkqk-cxttvelosa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=409.389}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ07072]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ00609]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ02693]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-5844]], menaquinol-9 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5844 PWY-5844]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=44781 44781]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=s-adenosylmethionine:2-demethylmenaquinol-9 methyltransferase}}
 
−
{{#set: ec-number=ec-2.1.1.163}}
 
−
{{#set: nb gene associated=6}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14594

  • common-name:
    • linustatin
  • smiles:
    • cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
  • inchi-key:
    • fersmfqbwvbkqk-cxttvelosa-n
  • molecular-weight:
    • 409.389

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14594&oldid=138699"