Difference between revisions of "CPD-14601"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Acyl-Phosphates == * common-name: ** an acyl phosphate == Reaction(s) known to consume the compound == * ACYLPHOSPHATASE-RXN == React...") |
(Created page with "Category:metabolite == Metabolite CPD-14601 == * common-name: ** mycophenolate * smiles: ** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc) * inchi-key: ** hpnsfsbz...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14601 == |
* common-name: | * common-name: | ||
| − | ** | + | ** mycophenolate |
| + | * smiles: | ||
| + | ** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc) | ||
| + | * inchi-key: | ||
| + | ** hpnsfsbzbahari-rudmxatfsa-m | ||
| + | * molecular-weight: | ||
| + | ** 319.333 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13607]] |
| + | * [[RXN-13608]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13605]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=mycophenolate}} |
| + | {{#set: inchi-key=inchikey=hpnsfsbzbahari-rudmxatfsa-m}} | ||
| + | {{#set: molecular-weight=319.333}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-14601
- common-name:
- mycophenolate
- smiles:
- cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc)
- inchi-key:
- hpnsfsbzbahari-rudmxatfsa-m
- molecular-weight:
- 319.333
