Difference between revisions of "CPD-14602"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35. RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.] ==...")
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * smiles: ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35. RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.] ==
+
== Metabolite CPD-14602 ==
* direction:
+
* common-name:
** left-to-right
+
** mycophenolic acid o-acyl-glucuronide
== Reaction formula ==
+
* smiles:
* 1.0 [[CPD-4205]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[CPD-15318]][c] '''+''' 1.0 [[CPD-4209]][c]
+
** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
== Gene(s) associated with this reaction  ==
+
* inchi-key:
== Pathway(s) ==
+
** qbmstezxamabff-uearnrkisa-m
== Reconstruction information  ==
+
* molecular-weight:
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
** 495.459
== External links  ==
+
== Reaction(s) known to consume the compound ==
{{#set: direction=left-to-right}}
+
* [[RXN-13605]]
{{#set: nb gene associated=0}}
+
== Reaction(s) known to produce the compound ==
{{#set: nb pathway associated=0}}
+
* [[RXN-13607]]
{{#set: reconstruction category=gap-filling}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction tool=meneco}}
+
{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
{{#set: reconstruction comment=added for gapfilling}}
+
{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
+
{{#set: molecular-weight=495.459}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-14602

  • common-name:
    • mycophenolic acid o-acyl-glucuronide
  • smiles:
    • cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
  • inchi-key:
    • qbmstezxamabff-uearnrkisa-m
  • molecular-weight:
    • 495.459

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality