Difference between revisions of "CPD-14602"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LACTOSE-SYNTHASE-RXN LACTOSE-SYNTHASE-RXN] == * direction: ** left-to-right * ec-number: ** [http:/...") |
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * smiles: ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14602 == |
| − | * | + | * common-name: |
| − | ** | + | ** mycophenolic acid o-acyl-glucuronide |
| − | * | + | * smiles: |
| − | ** [ | + | ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc) |
| − | == | + | * inchi-key: |
| − | + | ** qbmstezxamabff-uearnrkisa-m | |
| − | + | * molecular-weight: | |
| − | * | + | ** 495.459 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-13605]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-13607]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=mycophenolic acid o-acyl-glucuronide}} |
| − | * | + | {{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}} |
| − | + | {{#set: molecular-weight=495.459}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-14602
- common-name:
- mycophenolic acid o-acyl-glucuronide
- smiles:
- cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
- inchi-key:
- qbmstezxamabff-uearnrkisa-m
- molecular-weight:
- 495.459
