Difference between revisions of "CPD-14602"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-707 == * common-name: ** campesterol * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * smiles: ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-707 ==
+
== Metabolite CPD-14602 ==
 
* common-name:
 
* common-name:
** campesterol
+
** mycophenolic acid o-acyl-glucuronide
 
* smiles:
 
* smiles:
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+
** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
 
* inchi-key:
 
* inchi-key:
** sgnbvlswzmbqth-podylutmsa-n
+
** qbmstezxamabff-uearnrkisa-m
 
* molecular-weight:
 
* molecular-weight:
** 400.687
+
** 495.459
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4225]]
+
* [[RXN-13605]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13607]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=campesterol}}
+
{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
{{#set: inchi-key=inchikey=sgnbvlswzmbqth-podylutmsa-n}}
+
{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
{{#set: molecular-weight=400.687}}
+
{{#set: molecular-weight=495.459}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-14602

  • common-name:
    • mycophenolic acid o-acyl-glucuronide
  • smiles:
    • cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
  • inchi-key:
    • qbmstezxamabff-uearnrkisa-m
  • molecular-weight:
    • 495.459

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality