Difference between revisions of "CPD-14646"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17757 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate * smiles: ** cc(=o)nc2(c(o)oc(c...") |
(Created page with "Category:metabolite == Metabolite CPD-14646 == * common-name: ** 9-cis-β-carotene * smiles: ** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14646 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9-cis-β-carotene |
* smiles: | * smiles: | ||
| − | ** cc(= | + | ** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oenhqhleoonyie-bvzamqqesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 536.882 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13641]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13641]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9-cis-β-carotene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oenhqhleoonyie-bvzamqqesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=536.882}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-14646
- common-name:
- 9-cis-β-carotene
- smiles:
- cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c
- inchi-key:
- oenhqhleoonyie-bvzamqqesa-n
- molecular-weight:
- 536.882
