Difference between revisions of "CPD-14646"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13961 RXN-13961] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-14646 == * common-name: ** 9-cis-β-carotene * smiles: ** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-14646 == |
− | * | + | * common-name: |
− | ** | + | ** 9-cis-β-carotene |
− | * | + | * smiles: |
− | ** | + | ** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c |
− | == | + | * inchi-key: |
− | + | ** oenhqhleoonyie-bvzamqqesa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 536.882 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-13641]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | ** | + | * [[RXN-13641]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=9-cis-β-carotene}} | |
− | * | + | {{#set: inchi-key=inchikey=oenhqhleoonyie-bvzamqqesa-n}} |
− | * | + | {{#set: molecular-weight=536.882}} |
− | == | ||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-14646
- common-name:
- 9-cis-β-carotene
- smiles:
- cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c
- inchi-key:
- oenhqhleoonyie-bvzamqqesa-n
- molecular-weight:
- 536.882