Difference between revisions of "CPD-14675"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18266 == * transcription-direction: ** positive * right-end-position: ** 204836 * left-end-position: ** 195429 * centisome-position: ** 78.521805...")
(Created page with "Category:metabolite == Metabolite CPD-14675 == * common-name: ** pristanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ18266 ==
+
== Metabolite CPD-14675 ==
* transcription-direction:
+
* common-name:
** positive
+
** pristanoyl-coa
* right-end-position:
+
* smiles:
** 204836
+
** cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 195429
+
** xyjpsqpvcbnzht-tukysrjdsa-j
* centisome-position:
+
* molecular-weight:
** 78.521805   
+
** 1043.995
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN66-484]]
* [[2.4.1.198-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=pristanoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=xyjpsqpvcbnzht-tukysrjdsa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=1043.995}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[2.4.1.223-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-6558]]
 
** '''7''' reactions found over '''13''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=204836}}
 
{{#set: left-end-position=195429}}
 
{{#set: centisome-position=78.521805    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-14675

  • common-name:
    • pristanoyl-coa
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xyjpsqpvcbnzht-tukysrjdsa-j
  • molecular-weight:
    • 1043.995

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality