Difference between revisions of "CPD-14704"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...") |
(Created page with "Category:metabolite == Metabolite 5-Dephospho-DNA == * common-name: ** a 5'-dephospho-[dna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-HYDROXYL-K...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-Dephospho-DNA == |
* common-name: | * common-name: | ||
− | ** 5'- | + | ** a 5'-dephospho-[dna] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=5'- | + | {{#set: common-name=a 5'-dephospho-[dna]}} |
− | |||
− |
Revision as of 18:59, 14 January 2021
Contents
Metabolite 5-Dephospho-DNA
- common-name:
- a 5'-dephospho-[dna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-dephospho-[dna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.