Difference between revisions of "CPD-14736"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07135 == * transcription-direction: ** negative * right-end-position: ** 60314 * left-end-position: ** 13329 * centisome-position: ** 18.867844...") |
(Created page with "Category:metabolite == Metabolite CPD-14736 == * common-name: ** l-kynurenine * smiles: ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) * inchi-key: ** ygpsjzoedvaxab-qmmmgpob...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-14736 == |
− | * | + | * common-name: |
− | ** | + | ** l-kynurenine |
− | + | * smiles: | |
− | + | ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) | |
− | * | + | * inchi-key: |
− | ** | + | ** ygpsjzoedvaxab-qmmmgpobsa-n |
− | + | * molecular-weight: | |
− | + | ** 208.216 | |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[2.6.1.7-RXN]] | |
− | == | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[2.6.1.7-RXN]] |
− | + | * [[ARYLFORMAMIDASE-RXN]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=l-kynurenine}} | |
− | + | {{#set: inchi-key=inchikey=ygpsjzoedvaxab-qmmmgpobsa-n}} | |
− | + | {{#set: molecular-weight=208.216}} | |
− | * | ||
− | |||
− | ** | ||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14736
- common-name:
- l-kynurenine
- smiles:
- c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1)
- inchi-key:
- ygpsjzoedvaxab-qmmmgpobsa-n
- molecular-weight:
- 208.216