Difference between revisions of "CPD-14746"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BENZOYLSUCCINYL-COA == * common-name: ** benzoylsuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite Carotenoid-psi-end-group == * common-name: ** a carotenoid ψ-end group == Reaction(s) known to consume the compound == * [[RXN-12496]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BENZOYLSUCCINYL-COA ==
+
== Metabolite Carotenoid-psi-end-group ==
 
* common-name:
 
* common-name:
** benzoylsuccinyl-coa
+
** a carotenoid ψ-end group
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** sgnpjinsckfitg-ihebcorqsa-i
 
* molecular-weight:
 
** 966.676
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12496]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-905]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=benzoylsuccinyl-coa}}
+
{{#set: common-name=a carotenoid ψ-end group}}
{{#set: inchi-key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}}
 
{{#set: molecular-weight=966.676}}
 

Revision as of 13:08, 14 January 2021

Metabolite Carotenoid-psi-end-group

  • common-name:
    • a carotenoid ψ-end group

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality