Difference between revisions of "CPD-14758"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Myelin-N-o-methyl-arginines == * common-name: ** [myelin basic protein]-nω-methyl-arginine == Reaction(s) known to consume the comp...")
(Created page with "Category:metabolite == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == * common-name: ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate * smiles: ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Myelin-N-o-methyl-arginines ==
+
== Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE ==
 
* common-name:
 
* common-name:
** [myelin basic protein]-nω-methyl-arginine
+
** 2-dehydro-3-deoxy-d-gluconate 6-phosphate
 +
* smiles:
 +
** c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-]
 +
* inchi-key:
 +
** ovprppovaxrced-wvzvxsggsa-k
 +
* molecular-weight:
 +
** 255.098
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[KDPGALDOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.126-RXN]]
+
* [[PGLUCONDEHYDRAT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[myelin basic protein]-nω-methyl-arginine}}
+
{{#set: common-name=2-dehydro-3-deoxy-d-gluconate 6-phosphate}}
 +
{{#set: inchi-key=inchikey=ovprppovaxrced-wvzvxsggsa-k}}
 +
{{#set: molecular-weight=255.098}}

Revision as of 11:17, 15 January 2021

Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE

  • common-name:
    • 2-dehydro-3-deoxy-d-gluconate 6-phosphate
  • smiles:
    • c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • ovprppovaxrced-wvzvxsggsa-k
  • molecular-weight:
    • 255.098

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality