Difference between revisions of "CPD-14760"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19167 == * common-name: ** 3-oxo-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...") |
(Created page with "Category:metabolite == Metabolite CPD-110 == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi-key: ** ygsdefsmjlzeoe-uhfffaoysa-m * molecular-we...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-110 == |
* common-name: | * common-name: | ||
| − | ** | + | ** salicylate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c1(=cc=cc=c1o))([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ygsdefsmjlzeoe-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 137.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[SALICYLATE-1-MONOOXYGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXNQT-4366]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=salicylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ygsdefsmjlzeoe-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=137.115}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-110
- common-name:
- salicylate
- smiles:
- c(c1(=cc=cc=c1o))([o-])=o
- inchi-key:
- ygsdefsmjlzeoe-uhfffaoysa-m
- molecular-weight:
- 137.115
