Difference between revisions of "CPD-14760"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9955 == * common-name: ** ubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c...")
(Created page with "Category:metabolite == Metabolite CPD-14760 == * common-name: ** furfuryl methyl sulfide * smiles: ** cscc1(=cc=co1) * inchi-key: ** sksfhxvdhvkibn-uhfffaoysa-n * molecula...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9955 ==
+
== Metabolite CPD-14760 ==
 
* common-name:
 
* common-name:
** ubiquinol-7
+
** furfuryl methyl sulfide
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
** cscc1(=cc=co1)
 
* inchi-key:
 
* inchi-key:
** pfiusppkanbdhq-rjyqsxaysa-n
+
** sksfhxvdhvkibn-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 661.019
+
** 128.189
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9229]]
+
* [[RXN-13727]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-7}}
+
{{#set: common-name=furfuryl methyl sulfide}}
{{#set: inchi-key=inchikey=pfiusppkanbdhq-rjyqsxaysa-n}}
+
{{#set: inchi-key=inchikey=sksfhxvdhvkibn-uhfffaoysa-n}}
{{#set: molecular-weight=661.019}}
+
{{#set: molecular-weight=128.189}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-14760

  • common-name:
    • furfuryl methyl sulfide
  • smiles:
    • cscc1(=cc=co1)
  • inchi-key:
    • sksfhxvdhvkibn-uhfffaoysa-n
  • molecular-weight:
    • 128.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality