Difference between revisions of "CPD-14760"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-110 == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi-key: ** ygsdefsmjlzeoe-uhfffaoysa-m * molecular-we...") |
(Created page with "Category:metabolite == Metabolite INDOLE_ACETATE_AUXIN == * common-name: ** (indol-3-yl)acetate * smiles: ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** seovtrfcigri...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite INDOLE_ACETATE_AUXIN == |
* common-name: | * common-name: | ||
− | ** | + | ** (indol-3-yl)acetate |
* smiles: | * smiles: | ||
− | ** c( | + | ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** seovtrfcigrimh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 174.179 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10711]] |
+ | * [[RXN-10715]] | ||
+ | * [[RXN-1404]] | ||
+ | * [[RXN-5581]] | ||
+ | * [[RXNDQC-2]] | ||
+ | * [[RXNN-404]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(indol-3-yl)acetate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=seovtrfcigrimh-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.179}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite INDOLE_ACETATE_AUXIN
- common-name:
- (indol-3-yl)acetate
- smiles:
- c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- seovtrfcigrimh-uhfffaoysa-m
- molecular-weight:
- 174.179