Difference between revisions of "CPD-14760"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-110 == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi-key: ** ygsdefsmjlzeoe-uhfffaoysa-m * molecular-we...")
(Created page with "Category:metabolite == Metabolite INDOLE_ACETATE_AUXIN == * common-name: ** (indol-3-yl)acetate * smiles: ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** seovtrfcigri...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-110 ==
+
== Metabolite INDOLE_ACETATE_AUXIN ==
 
* common-name:
 
* common-name:
** salicylate
+
** (indol-3-yl)acetate
 
* smiles:
 
* smiles:
** c(c1(=cc=cc=c1o))([o-])=o
+
** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
 
* inchi-key:
 
* inchi-key:
** ygsdefsmjlzeoe-uhfffaoysa-m
+
** seovtrfcigrimh-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 137.115
+
** 174.179
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SALICYLATE-1-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXNQT-4366]]
+
* [[RXN-10711]]
 +
* [[RXN-10715]]
 +
* [[RXN-1404]]
 +
* [[RXN-5581]]
 +
* [[RXNDQC-2]]
 +
* [[RXNN-404]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=salicylate}}
+
{{#set: common-name=(indol-3-yl)acetate}}
{{#set: inchi-key=inchikey=ygsdefsmjlzeoe-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=seovtrfcigrimh-uhfffaoysa-m}}
{{#set: molecular-weight=137.115}}
+
{{#set: molecular-weight=174.179}}

Revision as of 15:26, 5 January 2021

Metabolite INDOLE_ACETATE_AUXIN

  • common-name:
    • (indol-3-yl)acetate
  • smiles:
    • c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
  • inchi-key:
    • seovtrfcigrimh-uhfffaoysa-m
  • molecular-weight:
    • 174.179

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality