Difference between revisions of "CPD-14760"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE_ACETATE_AUXIN == * common-name: ** (indol-3-yl)acetate * smiles: ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** seovtrfcigri...")
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INDOLE_ACETATE_AUXIN ==
+
== Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE ==
 
* common-name:
 
* common-name:
** (indol-3-yl)acetate
+
** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
 
* smiles:
 
* smiles:
** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
 
* inchi-key:
 
* inchi-key:
** seovtrfcigrimh-uhfffaoysa-m
+
** whmxlrrvaneoog-mvfiekmpsa-l
 
* molecular-weight:
 
* molecular-weight:
** 174.179
+
** 715.004
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10711]]
+
* [[2.5.1.42-RXN]]
* [[RXN-10715]]
 
* [[RXN-1404]]
 
* [[RXN-5581]]
 
* [[RXNDQC-2]]
 
* [[RXNN-404]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(indol-3-yl)acetate}}
+
{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
{{#set: inchi-key=inchikey=seovtrfcigrimh-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
{{#set: molecular-weight=174.179}}
+
{{#set: molecular-weight=715.004}}

Revision as of 13:09, 14 January 2021

Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE

  • common-name:
    • 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
  • inchi-key:
    • whmxlrrvaneoog-mvfiekmpsa-l
  • molecular-weight:
    • 715.004

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality