Difference between revisions of "CPD-14766"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17935 == * transcription-direction: ** negative * right-end-position: ** 73269 * left-end-position: ** 63525 * centisome-position: ** 25.018707...")
(Created page with "Category:metabolite == Metabolite CPD-7117 == * common-name: ** delphinidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17935 ==
+
== Metabolite CPD-7117 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** delphinidin-3-o-β-d-glucoside
−
* right-end-position:
+
* smiles:
−
** 73269
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
−
* left-end-position:
+
* inchi-key:
−
** 63525
+
** xenhpqqldpayij-pevlunpasa-m
−
* centisome-position:
+
* molecular-weight:
−
** 25.018707   
+
** 463.374
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8228]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GALACTOKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=delphinidin-3-o-β-d-glucoside}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=xenhpqqldpayij-pevlunpasa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=463.374}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[UDPGLUCEPIM-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6527]]
 
−
** '''7''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6317]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY66-422]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-3821]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7344]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[COLANSYN-PWY]]
 
−
** '''6''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-6397]]
 
−
** '''1''' reactions found over '''17''' reactions in the full pathway
 
−
* [[PWY-7328]]
 
−
** '''5''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=73269}}
 
−
{{#set: left-end-position=63525}}
 
−
{{#set: centisome-position=25.018707    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=8}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-7117

  • common-name:
    • delphinidin-3-o-β-d-glucoside
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
  • inchi-key:
    • xenhpqqldpayij-pevlunpasa-m
  • molecular-weight:
    • 463.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14766&oldid=46332"