Difference between revisions of "CPD-14795"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00281 R00281] == * direction: ** reversible * common-name: ** nadh:acceptor oxidoreductase == Reac...")
(Created page with "Category:metabolite == Metabolite CPD-14795 == * common-name: ** udp-n-acetyl-α-d-galactosamine * smiles: ** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00281 R00281] ==
+
== Metabolite CPD-14795 ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** nadh:acceptor oxidoreductase
+
** udp-n-acetyl-α-d-galactosamine
== Reaction formula ==
+
* smiles:
* 1.0 [[NADH]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[UBIQUINONE-8]][c] '''<=>''' 1.0 [[CPD-9956]][c] '''+''' 1.0 [[NAD]][c]
+
** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ02471]]
+
** lftytuazoprmmi-nessujcysa-l
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 605.342
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[RXN-13760]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14841]]
== External links  ==
+
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
{{#set: direction=reversible}}
+
== Reaction(s) known to produce the compound ==
{{#set: common-name=nadh:acceptor oxidoreductase}}
+
* [[RXN-13760]]
{{#set: nb gene associated=1}}
+
* [[RXN-14841]]
{{#set: nb pathway associated=0}}
+
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
{{#set: reconstruction category=orthology}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction tool=pantograph}}
+
{{#set: common-name=udp-n-acetyl-&alpha;-d-galactosamine}}
{{#set: reconstruction comment=n.a}}
+
{{#set: inchi-key=inchikey=lftytuazoprmmi-nessujcysa-l}}
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
{{#set: molecular-weight=605.342}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-14795

  • common-name:
    • udp-n-acetyl-α-d-galactosamine
  • smiles:
    • cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
  • inchi-key:
    • lftytuazoprmmi-nessujcysa-l
  • molecular-weight:
    • 605.342

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality