Difference between revisions of "CPD-14808"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviajx-gsvougtgsa...") |
(Created page with "Category:metabolite == Metabolite DEHYDROQUINATE == * common-name: ** 3-dehydroquinate * smiles: ** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1) * inchi-key: ** wvmwzwgzraxubk-sytvj...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEHYDROQUINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-dehydroquinate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wvmwzwgzraxubk-sytvjdicsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.144 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
| − | + | * [[3-DEHYDROQUINATE-SYNTHASE-RXN]] | |
| − | * [[ | + | * [[RXN-10032]] |
| − | + | * [[RXN-7967]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-dehydroquinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wvmwzwgzraxubk-sytvjdicsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.144}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite DEHYDROQUINATE
- common-name:
- 3-dehydroquinate
- smiles:
- c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1)
- inchi-key:
- wvmwzwgzraxubk-sytvjdicsa-m
- molecular-weight:
- 189.144
