Difference between revisions of "CPD-14808"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEHYDROQUINATE == * common-name: ** 3-dehydroquinate * smiles: ** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1) * inchi-key: ** wvmwzwgzraxubk-sytvj...")
(Created page with "Category:metabolite == Metabolite CPD-7005 == * common-name: ** geranylgeranyl chlorophyll a * smiles: ** c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEHYDROQUINATE ==
+
== Metabolite CPD-7005 ==
 
* common-name:
 
* common-name:
** 3-dehydroquinate
+
** geranylgeranyl chlorophyll a
 
* smiles:
 
* smiles:
** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1)
+
** c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c(n=1)=c7([c-](c(oc)=o)c(=o)c6(c(c)=c4(n([mg]n(c2=cc3(c(c)=c(cc)c(n=3)=c4))5)c=67))))))
 
* inchi-key:
 
* inchi-key:
** wvmwzwgzraxubk-sytvjdicsa-m
+
** qblsepresqjtci-znlwzyposa-m
 
* molecular-weight:
 
* molecular-weight:
** 189.144
+
** 886.447
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
* [[RXN-17428]]
 +
* [[RXN-7664]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
* [[RXN-7663]]
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
 
* [[RXN-10032]]
 
* [[RXN-7967]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-dehydroquinate}}
+
{{#set: common-name=geranylgeranyl chlorophyll a}}
{{#set: inchi-key=inchikey=wvmwzwgzraxubk-sytvjdicsa-m}}
+
{{#set: inchi-key=inchikey=qblsepresqjtci-znlwzyposa-m}}
{{#set: molecular-weight=189.144}}
+
{{#set: molecular-weight=886.447}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-7005

  • common-name:
    • geranylgeranyl chlorophyll a
  • smiles:
    • c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c(n=1)=c7([c-](c(oc)=o)c(=o)c6(c(c)=c4(n([mg]n(c2=cc3(c(c)=c(cc)c(n=3)=c4))5)c=67))))))
  • inchi-key:
    • qblsepresqjtci-znlwzyposa-m
  • molecular-weight:
    • 886.447

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality