Difference between revisions of "CPD-14808"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16975 == * transcription-direction: ** positive * right-end-position: ** 48564 * left-end-position: ** 30330 * centisome-position: ** 11.0183525...")
(Created page with "Category:metabolite == Metabolite CPD-14808 == * common-name: ** scyllo-inosose * smiles: ** c1(c(c(c(c(c1o)o)=o)o)o)o * inchi-key: ** vyegbdhsghxogt-hyfglkjpsa-n * molecu...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16975 ==
+
== Metabolite CPD-14808 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** scyllo-inosose
−
* right-end-position:
+
* smiles:
−
** 48564
+
** c1(c(c(c(c(c1o)o)=o)o)o)o
−
* left-end-position:
+
* inchi-key:
−
** 30330
+
** vyegbdhsghxogt-hyfglkjpsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 11.0183525   
+
** 178.141
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-13779]]
−
* [[2.1.1.124-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13779]]
−
* [[2.1.1.125-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=scyllo-inosose}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=vyegbdhsghxogt-hyfglkjpsa-n}}
−
* [[2.1.1.126-RXN]]
+
{{#set: molecular-weight=178.141}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14177]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-16889]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=48564}}
 
−
{{#set: left-end-position=30330}}
 
−
{{#set: centisome-position=11.0183525    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14808

  • common-name:
    • scyllo-inosose
  • smiles:
    • c1(c(c(c(c(c1o)o)=o)o)o)o
  • inchi-key:
    • vyegbdhsghxogt-hyfglkjpsa-n
  • molecular-weight:
    • 178.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14808&oldid=138110"