Difference between revisions of "CPD-14808"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04783 == * transcription-direction: ** negative * right-end-position: ** 241368 * left-end-position: ** 222986 * centisome-position: ** 44.12803...") |
(Created page with "Category:metabolite == Metabolite CPD-14808 == * common-name: ** scyllo-inosose * smiles: ** c1(c(c(c(c(c1o)o)=o)o)o)o * inchi-key: ** vyegbdhsghxogt-hyfglkjpsa-n * molecu...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-14808 == |
− | * | + | * common-name: |
− | ** | + | ** scyllo-inosose |
− | * | + | * smiles: |
− | ** | + | ** c1(c(c(c(c(c1o)o)=o)o)o)o |
− | * | + | * inchi-key: |
− | ** | + | ** vyegbdhsghxogt-hyfglkjpsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 178.141 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] | |
− | == Reaction(s) | + | * [[RXN-13779]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] |
− | + | * [[RXN-13779]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=scyllo-inosose}} | |
− | + | {{#set: inchi-key=inchikey=vyegbdhsghxogt-hyfglkjpsa-n}} | |
− | + | {{#set: molecular-weight=178.141}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-14808
- common-name:
- scyllo-inosose
- smiles:
- c1(c(c(c(c(c1o)o)=o)o)o)o
- inchi-key:
- vyegbdhsghxogt-hyfglkjpsa-n
- molecular-weight:
- 178.141