Difference between revisions of "CPD-14808"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13357 == * common-name: ** (2r)-2,3-dihydroxy-3-methylbutanoate * smiles: ** cc(c)(o)c(o)c(=o)[o-] * inchi-key: ** jteykufkxgdteu-vkh...") |
(Created page with "Category:metabolite == Metabolite CPD-14808 == * common-name: ** scyllo-inosose * smiles: ** c1(c(c(c(c(c1o)o)=o)o)o)o * inchi-key: ** vyegbdhsghxogt-hyfglkjpsa-n * molecu...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14808 == |
* common-name: | * common-name: | ||
| − | ** | + | ** scyllo-inosose |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(c(c(c(c1o)o)=o)o)o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vyegbdhsghxogt-hyfglkjpsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 178.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] |
| + | * [[RXN-13779]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] |
| − | * [[ | + | * [[RXN-13779]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=scyllo-inosose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vyegbdhsghxogt-hyfglkjpsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=178.141}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-14808
- common-name:
- scyllo-inosose
- smiles:
- c1(c(c(c(c(c1o)o)=o)o)o)o
- inchi-key:
- vyegbdhsghxogt-hyfglkjpsa-n
- molecular-weight:
- 178.141
