Difference between revisions of "CPD-14808"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13357 == * common-name: ** (2r)-2,3-dihydroxy-3-methylbutanoate * smiles: ** cc(c)(o)c(o)c(=o)[o-] * inchi-key: ** jteykufkxgdteu-vkh...")
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviajx-gsvougtgsa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13357 ==
+
== Metabolite GLYCEROL-3P ==
 
* common-name:
 
* common-name:
** (2r)-2,3-dihydroxy-3-methylbutanoate
+
** sn-glycerol 3-phosphate
 
* smiles:
 
* smiles:
** cc(c)(o)c(o)c(=o)[o-]
+
** c(op([o-])(=o)[o-])c(o)co
 
* inchi-key:
 
* inchi-key:
** jteykufkxgdteu-vkhmyheasa-m
+
** awucvroldviajx-gsvougtgsa-l
 
* molecular-weight:
 
* molecular-weight:
** 133.124
+
** 170.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 +
* [[G3PD2]]
 +
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 +
* [[RXN-10462]]
 +
* [[RXN-13112]]
 +
* [[RXN-13805]]
 +
* [[RXN-1381]]
 +
* [[RXN-14965]]
 +
* [[RXN-15045]]
 +
* [[RXN-15740]]
 +
* [[RXN-15745]]
 +
* [[RXN-16024]]
 +
* [[RXN-16117]]
 +
* [[RXN-17016]]
 +
* [[RXN-17017]]
 +
* [[RXN-17018]]
 +
* [[RXN0-5260]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETOLACTREDUCTOISOM-RXN]]
+
* [[1.1.1.8-RXN]]
* [[KARI_LPAREN_23dhmb_RPAREN_]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 +
* [[G3PD2]]
 +
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[GLYCPDIESTER-RXN]]
 +
* [[RXN-13112]]
 +
* [[RXN-13805]]
 +
* [[RXN-14073]]
 +
* [[RXN-14136]]
 +
* [[RXN-14160]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r)-2,3-dihydroxy-3-methylbutanoate}}
+
{{#set: common-name=sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=jteykufkxgdteu-vkhmyheasa-m}}
+
{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
{{#set: molecular-weight=133.124}}
+
{{#set: molecular-weight=170.058}}

Revision as of 18:55, 14 January 2021