Difference between revisions of "CPD-14828"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6701 == * common-name: ** 1d-myo-inositol 5-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inchi-key: ** in...") |
(Created page with "Category:metabolite == Metabolite CPD-14828 == * common-name: ** 1-c16:0-α,ω-dicarboxyl-2-lysophosphatidate * smiles: ** c(c(o)cop([o-])(=o)[o-])oc(ccccccccccc...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14828 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-c16:0-α,ω-dicarboxyl-2-lysophosphatidate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(o)cop([o-])(=o)[o-])oc(ccccccccccccccc(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lsetuzayschykl-qgzvfwflsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 437.446 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13805]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13805]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-c16:0-α,ω-dicarboxyl-2-lysophosphatidate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lsetuzayschykl-qgzvfwflsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=437.446}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-14828
- common-name:
- 1-c16:0-α,ω-dicarboxyl-2-lysophosphatidate
- smiles:
- c(c(o)cop([o-])(=o)[o-])oc(ccccccccccccccc(=o)[o-])=o
- inchi-key:
- lsetuzayschykl-qgzvfwflsa-k
- molecular-weight:
- 437.446
