Difference between revisions of "CPD-14873"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADP-SUGARS == * common-name: ** an adp-sugar == Reaction(s) known to consume the compound == * ADPSUGPPHOSPHAT-RXN == Reaction(s) kno...")
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADP-SUGARS ==
+
== Metabolite CPD-14873 ==
 
* common-name:
 
* common-name:
** an adp-sugar
+
** 3-amino-4-hydroxybenzoate
 +
* smiles:
 +
** c(=o)([o-])c1(c=c(n)c(o)=cc=1)
 +
* inchi-key:
 +
** mrbkrzapgucwos-uhfffaoysa-m
 +
* molecular-weight:
 +
** 152.129
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADPSUGPPHOSPHAT-RXN]]
+
* [[RXN-15414]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an adp-sugar}}
+
{{#set: common-name=3-amino-4-hydroxybenzoate}}
 +
{{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}}
 +
{{#set: molecular-weight=152.129}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14873

  • common-name:
    • 3-amino-4-hydroxybenzoate
  • smiles:
    • c(=o)([o-])c1(c=c(n)c(o)=cc=1)
  • inchi-key:
    • mrbkrzapgucwos-uhfffaoysa-m
  • molecular-weight:
    • 152.129

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality